3-{3-[4-(cyclobutylmethoxy)phenyl]-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl}-N-[2-(4-methoxyphenyl)ethyl]propanamide
Chemical Structure Depiction of
3-{3-[4-(cyclobutylmethoxy)phenyl]-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl}-N-[2-(4-methoxyphenyl)ethyl]propanamide
3-{3-[4-(cyclobutylmethoxy)phenyl]-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl}-N-[2-(4-methoxyphenyl)ethyl]propanamide
Compound characteristics
| Compound ID: | V025-5126 |
| Compound Name: | 3-{3-[4-(cyclobutylmethoxy)phenyl]-5-oxo-2,5-dihydro-1,2,4-triazin-6-yl}-N-[2-(4-methoxyphenyl)ethyl]propanamide |
| Molecular Weight: | 462.55 |
| Molecular Formula: | C26 H30 N4 O4 |
| Smiles: | COc1ccc(CCNC(CCC2C(N=C(c3ccc(cc3)OCC3CCC3)NN=2)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 2.605 |
| logD: | 1.6637 |
| logSw: | -3.0782 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.916 |
| InChI Key: | FXICGYHNLYANTE-UHFFFAOYSA-N |