3-fluoro-N-{3-[5-(4-fluorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}benzamide
Chemical Structure Depiction of
3-fluoro-N-{3-[5-(4-fluorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}benzamide
3-fluoro-N-{3-[5-(4-fluorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}benzamide
Compound characteristics
| Compound ID: | V025-5283 |
| Compound Name: | 3-fluoro-N-{3-[5-(4-fluorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl]phenyl}benzamide |
| Molecular Weight: | 450.44 |
| Molecular Formula: | C24 H20 F2 N4 O3 |
| Salt: | not_available |
| Smiles: | COCCOc1nc(c2ccc(cc2)F)n(c2cccc(c2)NC(c2cccc(c2)F)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.5794 |
| logD: | 4.5793 |
| logSw: | -4.4139 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.542 |
| InChI Key: | YTXWRVUPHBMUMX-UHFFFAOYSA-N |