4-methoxy-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)-N-[2-(morpholin-4-yl)ethyl]benzamide
Chemical Structure Depiction of
4-methoxy-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)-N-[2-(morpholin-4-yl)ethyl]benzamide
4-methoxy-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)-N-[2-(morpholin-4-yl)ethyl]benzamide
Compound characteristics
| Compound ID: | V025-5355 |
| Compound Name: | 4-methoxy-N-(2-{[(5-methylfuran-2-yl)methyl](2-phenylethyl)amino}-2-oxoethyl)-N-[2-(morpholin-4-yl)ethyl]benzamide |
| Molecular Weight: | 519.64 |
| Molecular Formula: | C30 H37 N3 O5 |
| Salt: | not_available |
| Smiles: | Cc1ccc(CN(CCc2ccccc2)C(CN(CCN2CCOCC2)C(c2ccc(cc2)OC)=O)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 3.1204 |
| logD: | 3.1157 |
| logSw: | -3.1408 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 58.516 |
| InChI Key: | MBYXUJDUSAPPPC-UHFFFAOYSA-N |