1-[4-(4-chlorobenzene-1-sulfonyl)-3-methylpiperazin-1-yl]-2-[4-(4-methylphenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]ethan-1-one
Chemical Structure Depiction of
1-[4-(4-chlorobenzene-1-sulfonyl)-3-methylpiperazin-1-yl]-2-[4-(4-methylphenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]ethan-1-one
1-[4-(4-chlorobenzene-1-sulfonyl)-3-methylpiperazin-1-yl]-2-[4-(4-methylphenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]ethan-1-one
Compound characteristics
| Compound ID: | V025-6776 |
| Compound Name: | 1-[4-(4-chlorobenzene-1-sulfonyl)-3-methylpiperazin-1-yl]-2-[4-(4-methylphenyl)-6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl]ethan-1-one |
| Molecular Weight: | 544.13 |
| Molecular Formula: | C27 H30 Cl N3 O3 S2 |
| Salt: | not_available |
| Smiles: | CC1CN(CCN1S(c1ccc(cc1)[Cl])(=O)=O)C(CN1CCc2c(ccs2)C1c1ccc(C)cc1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.1125 |
| logD: | 4.9863 |
| logSw: | -5.5881 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 52.036 |
| InChI Key: | LIHAPFGHEHDVAF-UHFFFAOYSA-N |