N-(3-chlorophenyl)-N'-(5-methyl-3-phenyl-1H-pyrazol-4-yl)urea
Chemical Structure Depiction of
N-(3-chlorophenyl)-N'-(5-methyl-3-phenyl-1H-pyrazol-4-yl)urea
N-(3-chlorophenyl)-N'-(5-methyl-3-phenyl-1H-pyrazol-4-yl)urea
Compound characteristics
| Compound ID: | V025-7122 |
| Compound Name: | N-(3-chlorophenyl)-N'-(5-methyl-3-phenyl-1H-pyrazol-4-yl)urea |
| Molecular Weight: | 326.78 |
| Molecular Formula: | C17 H15 Cl N4 O |
| Salt: | not_available |
| Smiles: | Cc1c(c(c2ccccc2)n[nH]1)NC(Nc1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.2291 |
| logD: | 4.229 |
| logSw: | -4.5531 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 54.983 |
| InChI Key: | PKDXQBOQGWITJP-UHFFFAOYSA-N |