2-chloro-N-{[5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl}-N-[(4-fluorophenyl)methyl]benzamide
Chemical Structure Depiction of
2-chloro-N-{[5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl}-N-[(4-fluorophenyl)methyl]benzamide
2-chloro-N-{[5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl}-N-[(4-fluorophenyl)methyl]benzamide
Compound characteristics
| Compound ID: | V025-7795 |
| Compound Name: | 2-chloro-N-{[5-(3,4-dimethoxyphenyl)-1,2-oxazol-3-yl]methyl}-N-[(4-fluorophenyl)methyl]benzamide |
| Molecular Weight: | 480.92 |
| Molecular Formula: | C26 H22 Cl F N2 O4 |
| Smiles: | COc1ccc(cc1OC)c1cc(CN(Cc2ccc(cc2)F)C(c2ccccc2[Cl])=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.7706 |
| logD: | 4.7706 |
| logSw: | -4.87 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.469 |
| InChI Key: | PMDSKPAWOPPRLM-UHFFFAOYSA-N |