N-{2-[(1,4-diphenyl-1H-imidazol-2-yl)amino]-2-oxoethyl}-2-fluoro-N-[(oxolan-2-yl)methyl]benzamide
Chemical Structure Depiction of
N-{2-[(1,4-diphenyl-1H-imidazol-2-yl)amino]-2-oxoethyl}-2-fluoro-N-[(oxolan-2-yl)methyl]benzamide
N-{2-[(1,4-diphenyl-1H-imidazol-2-yl)amino]-2-oxoethyl}-2-fluoro-N-[(oxolan-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | V025-8803 |
| Compound Name: | N-{2-[(1,4-diphenyl-1H-imidazol-2-yl)amino]-2-oxoethyl}-2-fluoro-N-[(oxolan-2-yl)methyl]benzamide |
| Molecular Weight: | 498.56 |
| Molecular Formula: | C29 H27 F N4 O3 |
| Salt: | not_available |
| Smiles: | C1CC(CN(CC(Nc2nc(cn2c2ccccc2)c2ccccc2)=O)C(c2ccccc2F)=O)OC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5582 |
| logD: | 4.5582 |
| logSw: | -4.4054 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.047 |
| InChI Key: | AHMWGMXNGHMURQ-HSZRJFAPSA-N |