(4-chlorophenyl){4-[3-(4-methoxyphenyl)[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(4-chlorophenyl){4-[3-(4-methoxyphenyl)[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl}methanone
(4-chlorophenyl){4-[3-(4-methoxyphenyl)[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | V025-8855 |
| Compound Name: | (4-chlorophenyl){4-[3-(4-methoxyphenyl)[1,2,4]triazolo[4,3-c]quinazolin-5-yl]piperazin-1-yl}methanone |
| Molecular Weight: | 498.97 |
| Molecular Formula: | C27 H23 Cl N6 O2 |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1)c1nnc2c3ccccc3nc(N3CCN(CC3)C(c3ccc(cc3)[Cl])=O)n12 |
| Stereo: | ACHIRAL |
| logP: | 4.8846 |
| logD: | 4.8235 |
| logSw: | -5.0576 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.993 |
| InChI Key: | ADHXSSGBZPHFCJ-UHFFFAOYSA-N |