4-chloro-N-({1-[(3,4-dichlorophenyl)methyl]-1H-imidazol-2-yl}methyl)-N-ethylbenzamide
Chemical Structure Depiction of
4-chloro-N-({1-[(3,4-dichlorophenyl)methyl]-1H-imidazol-2-yl}methyl)-N-ethylbenzamide
4-chloro-N-({1-[(3,4-dichlorophenyl)methyl]-1H-imidazol-2-yl}methyl)-N-ethylbenzamide
Compound characteristics
| Compound ID: | V025-9535 |
| Compound Name: | 4-chloro-N-({1-[(3,4-dichlorophenyl)methyl]-1H-imidazol-2-yl}methyl)-N-ethylbenzamide |
| Molecular Weight: | 422.74 |
| Molecular Formula: | C20 H18 Cl3 N3 O |
| Salt: | not_available |
| Smiles: | CCN(Cc1nccn1Cc1ccc(c(c1)[Cl])[Cl])C(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.6994 |
| logD: | 4.6991 |
| logSw: | -4.8481 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 28.66 |
| InChI Key: | XDZGFQPPQXRNNK-UHFFFAOYSA-N |