N-{[3-ethyl-1-(4-fluorophenyl)-5-phenoxy-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]benzamide
Chemical Structure Depiction of
N-{[3-ethyl-1-(4-fluorophenyl)-5-phenoxy-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]benzamide
N-{[3-ethyl-1-(4-fluorophenyl)-5-phenoxy-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | V025-9745 |
| Compound Name: | N-{[3-ethyl-1-(4-fluorophenyl)-5-phenoxy-1H-pyrazol-4-yl]methyl}-N-[(oxolan-2-yl)methyl]benzamide |
| Molecular Weight: | 499.59 |
| Molecular Formula: | C30 H30 F N3 O3 |
| Salt: | not_available |
| Smiles: | CCc1c(CN(CC2CCCO2)C(c2ccccc2)=O)c(n(c2ccc(cc2)F)n1)Oc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3801 |
| logD: | 5.3801 |
| logSw: | -5.3335 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 46.203 |
| InChI Key: | JVWPCZZGKHZMEU-AREMUKBSSA-N |