N-{[3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(4-fluorophenyl)methyl]cyclopropanecarboxamide
					Chemical Structure Depiction of
N-{[3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(4-fluorophenyl)methyl]cyclopropanecarboxamide
			N-{[3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(4-fluorophenyl)methyl]cyclopropanecarboxamide
Compound characteristics
| Compound ID: | V026-0425 | 
| Compound Name: | N-{[3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(4-fluorophenyl)methyl]cyclopropanecarboxamide | 
| Molecular Weight: | 421.3 | 
| Molecular Formula: | C21 H19 Cl2 F N2 O2 | 
| Smiles: | C1CC1C(N(CC1CC(c2ccc(c(c2)[Cl])[Cl])=NO1)Cc1ccc(cc1)F)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 5.1797 | 
| logD: | 5.1797 | 
| logSw: | -5.8922 | 
| Hydrogen bond acceptors count: | 4 | 
| Polar surface area: | 39.537 | 
| InChI Key: | RGWNDBLXIQWBQT-QGZVFWFLSA-N | 
 
				 
				