2-(3-methylphenyl)-4-[(3-methylphenyl)methyl]-6-(morpholine-4-carbonyl)-1,2,4-triazine-3,5(2H,4H)-dione
Chemical Structure Depiction of
2-(3-methylphenyl)-4-[(3-methylphenyl)methyl]-6-(morpholine-4-carbonyl)-1,2,4-triazine-3,5(2H,4H)-dione
2-(3-methylphenyl)-4-[(3-methylphenyl)methyl]-6-(morpholine-4-carbonyl)-1,2,4-triazine-3,5(2H,4H)-dione
Compound characteristics
| Compound ID: | V026-0556 |
| Compound Name: | 2-(3-methylphenyl)-4-[(3-methylphenyl)methyl]-6-(morpholine-4-carbonyl)-1,2,4-triazine-3,5(2H,4H)-dione |
| Molecular Weight: | 420.47 |
| Molecular Formula: | C23 H24 N4 O4 |
| Salt: | not_available |
| Smiles: | Cc1cccc(CN2C(C(C(N3CCOCC3)=O)=NN(C2=O)c2cccc(C)c2)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.2283 |
| logD: | 3.2283 |
| logSw: | -3.1008 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 66.802 |
| InChI Key: | MUFCDRAXRIZUNG-UHFFFAOYSA-N |