3-fluoro-N-methyl-N-{2-oxo-2-[5-phenyl-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]ethyl}benzamide
Chemical Structure Depiction of
3-fluoro-N-methyl-N-{2-oxo-2-[5-phenyl-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]ethyl}benzamide
3-fluoro-N-methyl-N-{2-oxo-2-[5-phenyl-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]ethyl}benzamide
Compound characteristics
| Compound ID: | V026-0585 |
| Compound Name: | 3-fluoro-N-methyl-N-{2-oxo-2-[5-phenyl-3-(thiophen-2-yl)-4,5-dihydro-1H-pyrazol-1-yl]ethyl}benzamide |
| Molecular Weight: | 421.49 |
| Molecular Formula: | C23 H20 F N3 O2 S |
| Salt: | not_available |
| Smiles: | CN(CC(N1C(CC(c2cccs2)=N1)c1ccccc1)=O)C(c1cccc(c1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9746 |
| logD: | 3.9746 |
| logSw: | -4.0991 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 44.028 |
| InChI Key: | OWMYWEZKFASDGE-HXUWFJFHSA-N |