N'-tert-butyl-N-[(furan-2-yl)methyl]-N-{2-oxo-2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]ethyl}urea
Chemical Structure Depiction of
N'-tert-butyl-N-[(furan-2-yl)methyl]-N-{2-oxo-2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]ethyl}urea
N'-tert-butyl-N-[(furan-2-yl)methyl]-N-{2-oxo-2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]ethyl}urea
Compound characteristics
| Compound ID: | V026-0649 |
| Compound Name: | N'-tert-butyl-N-[(furan-2-yl)methyl]-N-{2-oxo-2-[4-(6-phenylpyridazin-3-yl)piperazin-1-yl]ethyl}urea |
| Molecular Weight: | 476.58 |
| Molecular Formula: | C26 H32 N6 O3 |
| Salt: | not_available |
| Smiles: | CC(C)(C)NC(N(CC(N1CCN(CC1)c1ccc(c2ccccc2)nn1)=O)Cc1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.546 |
| logD: | 3.5422 |
| logSw: | -3.4449 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.753 |
| InChI Key: | FKFCUFGTLDMHFG-UHFFFAOYSA-N |