3,4-dimethoxy-N-{5-methyl-3-[1-(methylamino)-1-oxobutan-2-yl]-1,3-thiazol-2(3H)-ylidene}benzamide
Chemical Structure Depiction of
3,4-dimethoxy-N-{5-methyl-3-[1-(methylamino)-1-oxobutan-2-yl]-1,3-thiazol-2(3H)-ylidene}benzamide
3,4-dimethoxy-N-{5-methyl-3-[1-(methylamino)-1-oxobutan-2-yl]-1,3-thiazol-2(3H)-ylidene}benzamide
Compound characteristics
| Compound ID: | V026-0769 |
| Compound Name: | 3,4-dimethoxy-N-{5-methyl-3-[1-(methylamino)-1-oxobutan-2-yl]-1,3-thiazol-2(3H)-ylidene}benzamide |
| Molecular Weight: | 377.46 |
| Molecular Formula: | C18 H23 N3 O4 S |
| Smiles: | CCC(C(NC)=O)N1C=C(C)SC/1=N/C(c1ccc(c(c1)OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.4308 |
| logD: | 1.4308 |
| logSw: | -2.413 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.848 |
| InChI Key: | DKNUQVIGXBBYGF-HGENEIFLSA-N |