(4-{[7-methoxy-2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-3-yl]methyl}piperazin-1-yl)[4-(trifluoromethyl)phenyl]methanone
Chemical Structure Depiction of
(4-{[7-methoxy-2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-3-yl]methyl}piperazin-1-yl)[4-(trifluoromethyl)phenyl]methanone
(4-{[7-methoxy-2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-3-yl]methyl}piperazin-1-yl)[4-(trifluoromethyl)phenyl]methanone
Compound characteristics
| Compound ID: | V026-1316 |
| Compound Name: | (4-{[7-methoxy-2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazol-3-yl]methyl}piperazin-1-yl)[4-(trifluoromethyl)phenyl]methanone |
| Molecular Weight: | 564.63 |
| Molecular Formula: | C30 H27 F3 N4 O2 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)c1c(CN2CCN(CC2)C(c2ccc(cc2)C(F)(F)F)=O)n2c3ccc(cc3sc2n1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.9325 |
| logD: | 5.8781 |
| logSw: | -5.5383 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 36.485 |
| InChI Key: | XUUQVLRVLQQBFG-UHFFFAOYSA-N |