ethyl 1-{4-[({4-[4-(4-methoxyphenyl)piperazin-1-yl]-5,6-dimethylpyrimidin-2-yl}sulfanyl)methyl]benzoyl}piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-{4-[({4-[4-(4-methoxyphenyl)piperazin-1-yl]-5,6-dimethylpyrimidin-2-yl}sulfanyl)methyl]benzoyl}piperidine-3-carboxylate
ethyl 1-{4-[({4-[4-(4-methoxyphenyl)piperazin-1-yl]-5,6-dimethylpyrimidin-2-yl}sulfanyl)methyl]benzoyl}piperidine-3-carboxylate
Compound characteristics
| Compound ID: | V026-1522 |
| Compound Name: | ethyl 1-{4-[({4-[4-(4-methoxyphenyl)piperazin-1-yl]-5,6-dimethylpyrimidin-2-yl}sulfanyl)methyl]benzoyl}piperidine-3-carboxylate |
| Molecular Weight: | 603.78 |
| Molecular Formula: | C33 H41 N5 O4 S |
| Salt: | not_available |
| Smiles: | CCOC(C1CCCN(C1)C(c1ccc(CSc2nc(C)c(C)c(n2)N2CCN(CC2)c2ccc(cc2)OC)cc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3847 |
| logD: | 5.383 |
| logSw: | -5.243 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 69.362 |
| InChI Key: | DZMUUNUMXGUZAU-MHZLTWQESA-N |