2-(3-chlorophenyl)-5-(3,4-dimethylphenoxy)-4-[3-(piperidine-1-carbonyl)anilino]pyridazin-3(2H)-one
					Chemical Structure Depiction of
2-(3-chlorophenyl)-5-(3,4-dimethylphenoxy)-4-[3-(piperidine-1-carbonyl)anilino]pyridazin-3(2H)-one
			2-(3-chlorophenyl)-5-(3,4-dimethylphenoxy)-4-[3-(piperidine-1-carbonyl)anilino]pyridazin-3(2H)-one
Compound characteristics
| Compound ID: | V026-2405 | 
| Compound Name: | 2-(3-chlorophenyl)-5-(3,4-dimethylphenoxy)-4-[3-(piperidine-1-carbonyl)anilino]pyridazin-3(2H)-one | 
| Molecular Weight: | 529.04 | 
| Molecular Formula: | C30 H29 Cl N4 O3 | 
| Salt: | not_available | 
| Smiles: | Cc1ccc(cc1C)OC1C=NN(C(C=1Nc1cccc(c1)C(N1CCCCC1)=O)=O)c1cccc(c1)[Cl] | 
| Stereo: | ACHIRAL | 
| logP: | 6.1634 | 
| logD: | 6.156 | 
| logSw: | -6.1628 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 59.965 | 
| InChI Key: | TWTNHTUWKULIOG-UHFFFAOYSA-N | 
 
				 
				