5-(2,5-dimethoxyphenyl)-N-(3-{[(4-fluorophenyl)methyl]amino}-3-oxopropyl)-N-[(oxolan-2-yl)methyl]-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(2,5-dimethoxyphenyl)-N-(3-{[(4-fluorophenyl)methyl]amino}-3-oxopropyl)-N-[(oxolan-2-yl)methyl]-1,2-oxazole-3-carboxamide
5-(2,5-dimethoxyphenyl)-N-(3-{[(4-fluorophenyl)methyl]amino}-3-oxopropyl)-N-[(oxolan-2-yl)methyl]-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | V026-3120 |
| Compound Name: | 5-(2,5-dimethoxyphenyl)-N-(3-{[(4-fluorophenyl)methyl]amino}-3-oxopropyl)-N-[(oxolan-2-yl)methyl]-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 511.55 |
| Molecular Formula: | C27 H30 F N3 O6 |
| Salt: | not_available |
| Smiles: | COc1ccc(c(c1)c1cc(C(N(CCC(NCc2ccc(cc2)F)=O)CC2CCCO2)=O)no1)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.97 |
| logD: | 2.97 |
| logSw: | -3.3589 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.992 |
| InChI Key: | AIYLCNIAOXSRHR-OAQYLSRUSA-N |