3,4-dimethoxy-N-[3-({2-[(2-methoxyethyl)carbamoyl]phenyl}methyl)-1,3-thiazol-2(3H)-ylidene]benzamide
Chemical Structure Depiction of
3,4-dimethoxy-N-[3-({2-[(2-methoxyethyl)carbamoyl]phenyl}methyl)-1,3-thiazol-2(3H)-ylidene]benzamide
3,4-dimethoxy-N-[3-({2-[(2-methoxyethyl)carbamoyl]phenyl}methyl)-1,3-thiazol-2(3H)-ylidene]benzamide
Compound characteristics
| Compound ID: | V026-3164 |
| Compound Name: | 3,4-dimethoxy-N-[3-({2-[(2-methoxyethyl)carbamoyl]phenyl}methyl)-1,3-thiazol-2(3H)-ylidene]benzamide |
| Molecular Weight: | 455.53 |
| Molecular Formula: | C23 H25 N3 O5 S |
| Salt: | not_available |
| Smiles: | COCCNC(c1ccccc1CN1C=CSC/1=N/C(c1ccc(c(c1)OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2208 |
| logD: | 2.2208 |
| logSw: | -3.0905 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74 |
| InChI Key: | GLJRKISXWLQHRU-UHFFFAOYSA-N |