2,4-dichloro-N-(2-{[1-(3,4-dimethoxyphenyl)-4-phenyl-1H-imidazol-2-yl]amino}-2-oxoethyl)-N-(prop-2-en-1-yl)benzamide
Chemical Structure Depiction of
2,4-dichloro-N-(2-{[1-(3,4-dimethoxyphenyl)-4-phenyl-1H-imidazol-2-yl]amino}-2-oxoethyl)-N-(prop-2-en-1-yl)benzamide
2,4-dichloro-N-(2-{[1-(3,4-dimethoxyphenyl)-4-phenyl-1H-imidazol-2-yl]amino}-2-oxoethyl)-N-(prop-2-en-1-yl)benzamide
Compound characteristics
| Compound ID: | V026-3374 |
| Compound Name: | 2,4-dichloro-N-(2-{[1-(3,4-dimethoxyphenyl)-4-phenyl-1H-imidazol-2-yl]amino}-2-oxoethyl)-N-(prop-2-en-1-yl)benzamide |
| Molecular Weight: | 565.46 |
| Molecular Formula: | C29 H26 Cl2 N4 O4 |
| Salt: | not_available |
| Smiles: | COc1ccc(cc1OC)n1cc(c2ccccc2)nc1NC(CN(CC=C)C(c1ccc(cc1[Cl])[Cl])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7581 |
| logD: | 5.7581 |
| logSw: | -5.948 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.904 |
| InChI Key: | RNCWFOCRYZSREB-UHFFFAOYSA-N |