ethyl 1-[5-({[4-phenyl-6-(pyrrolidin-1-yl)pyrimidin-2-yl]sulfanyl}methyl)furan-2-carbonyl]piperidine-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[5-({[4-phenyl-6-(pyrrolidin-1-yl)pyrimidin-2-yl]sulfanyl}methyl)furan-2-carbonyl]piperidine-3-carboxylate
ethyl 1-[5-({[4-phenyl-6-(pyrrolidin-1-yl)pyrimidin-2-yl]sulfanyl}methyl)furan-2-carbonyl]piperidine-3-carboxylate
Compound characteristics
| Compound ID: | V026-3777 |
| Compound Name: | ethyl 1-[5-({[4-phenyl-6-(pyrrolidin-1-yl)pyrimidin-2-yl]sulfanyl}methyl)furan-2-carbonyl]piperidine-3-carboxylate |
| Molecular Weight: | 520.65 |
| Molecular Formula: | C28 H32 N4 O4 S |
| Salt: | not_available |
| Smiles: | CCOC(C1CCCN(C1)C(c1ccc(CSc2nc(cc(n2)N2CCCC2)c2ccccc2)o1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.9741 |
| logD: | 5.9739 |
| logSw: | -5.3808 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 65.447 |
| InChI Key: | ICSFOQSYBXTQMF-NRFANRHFSA-N |