N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-{[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino}-3-oxopropyl)-4-(trifluoromethyl)benzamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-{[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino}-3-oxopropyl)-4-(trifluoromethyl)benzamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-{[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino}-3-oxopropyl)-4-(trifluoromethyl)benzamide
Compound characteristics
| Compound ID: | V026-4193 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-(3-{[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]amino}-3-oxopropyl)-4-(trifluoromethyl)benzamide |
| Molecular Weight: | 598.64 |
| Molecular Formula: | C30 H29 F3 N4 O4 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)c1nnc(NC(CCN(CCc2ccc(c(c2)OC)OC)C(c2ccc(cc2)C(F)(F)F)=O)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 5.4092 |
| logD: | 5.4089 |
| logSw: | -5.4361 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.818 |
| InChI Key: | YBKWHSDUYXEPGN-UHFFFAOYSA-N |