N-benzyl-2-chloro-N-{[1-(3-chlorophenyl)-5-(dimethylamino)-3-methyl-1H-pyrazol-4-yl]methyl}benzamide
Chemical Structure Depiction of
N-benzyl-2-chloro-N-{[1-(3-chlorophenyl)-5-(dimethylamino)-3-methyl-1H-pyrazol-4-yl]methyl}benzamide
N-benzyl-2-chloro-N-{[1-(3-chlorophenyl)-5-(dimethylamino)-3-methyl-1H-pyrazol-4-yl]methyl}benzamide
Compound characteristics
| Compound ID: | V026-5106 |
| Compound Name: | N-benzyl-2-chloro-N-{[1-(3-chlorophenyl)-5-(dimethylamino)-3-methyl-1H-pyrazol-4-yl]methyl}benzamide |
| Molecular Weight: | 493.44 |
| Molecular Formula: | C27 H26 Cl2 N4 O |
| Salt: | not_available |
| Smiles: | Cc1c(CN(Cc2ccccc2)C(c2ccccc2[Cl])=O)c(N(C)C)n(c2cccc(c2)[Cl])n1 |
| Stereo: | ACHIRAL |
| logP: | 5.6419 |
| logD: | 5.6419 |
| logSw: | -5.8049 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 32.206 |
| InChI Key: | GSOVNPZNWODLTP-UHFFFAOYSA-N |