N-ethyl-4-[({4-[4-(2-fluorophenyl)piperazin-1-yl]-6-phenylpyrimidin-2-yl}sulfanyl)methyl]-N-methylbenzamide
Chemical Structure Depiction of
N-ethyl-4-[({4-[4-(2-fluorophenyl)piperazin-1-yl]-6-phenylpyrimidin-2-yl}sulfanyl)methyl]-N-methylbenzamide
N-ethyl-4-[({4-[4-(2-fluorophenyl)piperazin-1-yl]-6-phenylpyrimidin-2-yl}sulfanyl)methyl]-N-methylbenzamide
Compound characteristics
| Compound ID: | V026-5184 |
| Compound Name: | N-ethyl-4-[({4-[4-(2-fluorophenyl)piperazin-1-yl]-6-phenylpyrimidin-2-yl}sulfanyl)methyl]-N-methylbenzamide |
| Molecular Weight: | 541.69 |
| Molecular Formula: | C31 H32 F N5 O S |
| Salt: | not_available |
| Smiles: | CCN(C)C(c1ccc(CSc2nc(cc(n2)N2CCN(CC2)c2ccccc2F)c2ccccc2)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4499 |
| logD: | 6.4496 |
| logSw: | -5.6785 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.011 |
| InChI Key: | ICFZEXXDWCRXNE-UHFFFAOYSA-N |