{4-[({4-[4-(2-chlorophenyl)piperazin-1-yl]-6-phenylpyrimidin-2-yl}sulfanyl)methyl]phenyl}(morpholin-4-yl)methanone
Chemical Structure Depiction of
{4-[({4-[4-(2-chlorophenyl)piperazin-1-yl]-6-phenylpyrimidin-2-yl}sulfanyl)methyl]phenyl}(morpholin-4-yl)methanone
{4-[({4-[4-(2-chlorophenyl)piperazin-1-yl]-6-phenylpyrimidin-2-yl}sulfanyl)methyl]phenyl}(morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | V026-5219 |
| Compound Name: | {4-[({4-[4-(2-chlorophenyl)piperazin-1-yl]-6-phenylpyrimidin-2-yl}sulfanyl)methyl]phenyl}(morpholin-4-yl)methanone |
| Molecular Weight: | 586.16 |
| Molecular Formula: | C32 H32 Cl N5 O2 S |
| Salt: | not_available |
| Smiles: | C1CN(CCN1c1ccccc1[Cl])c1cc(c2ccccc2)nc(n1)SCc1ccc(cc1)C(N1CCOCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.3462 |
| logD: | 6.3459 |
| logSw: | -6.2574 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.421 |
| InChI Key: | LFVXCIVFFDEFDV-UHFFFAOYSA-N |