N-(4-{[1-(4-methoxyphenyl)-4-(4-methylanilino)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl]sulfanyl}phenyl)benzamide
Chemical Structure Depiction of
N-(4-{[1-(4-methoxyphenyl)-4-(4-methylanilino)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl]sulfanyl}phenyl)benzamide
N-(4-{[1-(4-methoxyphenyl)-4-(4-methylanilino)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl]sulfanyl}phenyl)benzamide
Compound characteristics
| Compound ID: | V026-5447 |
| Compound Name: | N-(4-{[1-(4-methoxyphenyl)-4-(4-methylanilino)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl]sulfanyl}phenyl)benzamide |
| Molecular Weight: | 535.62 |
| Molecular Formula: | C31 H25 N3 O4 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1)NC1=C(C(N(C1=O)c1ccc(cc1)OC)=O)Sc1ccc(cc1)NC(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5487 |
| logD: | 5.5485 |
| logSw: | -5.5672 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.626 |
| InChI Key: | SDMNVWKNPRUSPN-UHFFFAOYSA-N |