(2-chlorophenyl)(4-{[2-(4-chlorophenyl)-6-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl}piperazin-1-yl)methanone
Chemical Structure Depiction of
(2-chlorophenyl)(4-{[2-(4-chlorophenyl)-6-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl}piperazin-1-yl)methanone
(2-chlorophenyl)(4-{[2-(4-chlorophenyl)-6-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl}piperazin-1-yl)methanone
Compound characteristics
| Compound ID: | V026-6918 |
| Compound Name: | (2-chlorophenyl)(4-{[2-(4-chlorophenyl)-6-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]methyl}piperazin-1-yl)methanone |
| Molecular Weight: | 586.48 |
| Molecular Formula: | C31 H25 Cl2 N5 O3 |
| Salt: | not_available |
| Smiles: | C1CN(CCN1Cc1c(c2ccc(cc2)[Cl])nc2ccc(cn12)c1cccc(c1)[N+]([O-])=O)C(c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.1779 |
| logD: | 6.1703 |
| logSw: | -6.0222 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 61.797 |
| InChI Key: | SMCLUPNXRQGDEG-UHFFFAOYSA-N |