N-[3-(diethylamino)-3-oxopropyl]-N-ethyl-2,5-dimethylfuran-3-carboxamide
Chemical Structure Depiction of
N-[3-(diethylamino)-3-oxopropyl]-N-ethyl-2,5-dimethylfuran-3-carboxamide
N-[3-(diethylamino)-3-oxopropyl]-N-ethyl-2,5-dimethylfuran-3-carboxamide
Compound characteristics
| Compound ID: | V026-7015 |
| Compound Name: | N-[3-(diethylamino)-3-oxopropyl]-N-ethyl-2,5-dimethylfuran-3-carboxamide |
| Molecular Weight: | 294.39 |
| Molecular Formula: | C16 H26 N2 O3 |
| Smiles: | CCN(CC)C(CCN(CC)C(c1cc(C)oc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.713 |
| logD: | 1.713 |
| logSw: | -2.0101 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.576 |
| InChI Key: | BRPOKIQTWIWROL-UHFFFAOYSA-N |