[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl](3-fluorophenyl)methanone
Chemical Structure Depiction of
[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl](3-fluorophenyl)methanone
[2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl](3-fluorophenyl)methanone
Compound characteristics
| Compound ID: | V026-7119 |
| Compound Name: | [2-(2,5-dimethoxyphenyl)-1,3-thiazolidin-3-yl](3-fluorophenyl)methanone |
| Molecular Weight: | 347.41 |
| Molecular Formula: | C18 H18 F N O3 S |
| Smiles: | COc1ccc(c(c1)C1N(CCS1)C(c1cccc(c1)F)=O)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6125 |
| logD: | 3.6125 |
| logSw: | -3.8422 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.851 |
| InChI Key: | GYGJCILUGOHGGQ-SFHVURJKSA-N |