N-{[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(3-chlorophenyl)methyl]cyclopropanecarboxamide
Chemical Structure Depiction of
N-{[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(3-chlorophenyl)methyl]cyclopropanecarboxamide
N-{[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(3-chlorophenyl)methyl]cyclopropanecarboxamide
Compound characteristics
| Compound ID: | V026-7301 |
| Compound Name: | N-{[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl}-N-[(3-chlorophenyl)methyl]cyclopropanecarboxamide |
| Molecular Weight: | 403.31 |
| Molecular Formula: | C21 H20 Cl2 N2 O2 |
| Salt: | not_available |
| Smiles: | C1CC1C(N(CC1CC(c2ccc(cc2)[Cl])=NO1)Cc1cccc(c1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1425 |
| logD: | 5.1425 |
| logSw: | -5.7764 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 39.537 |
| InChI Key: | XMUPUZXDGZJUHN-LJQANCHMSA-N |