1-[5-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-(4-methylpiperidin-1-yl)ethan-1-one
Chemical Structure Depiction of
1-[5-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-(4-methylpiperidin-1-yl)ethan-1-one
1-[5-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-(4-methylpiperidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | V026-7696 |
| Compound Name: | 1-[5-(2,4-dimethoxyphenyl)-3-(2,4-dimethylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-(4-methylpiperidin-1-yl)ethan-1-one |
| Molecular Weight: | 449.59 |
| Molecular Formula: | C27 H35 N3 O3 |
| Salt: | not_available |
| Smiles: | CC1CCN(CC1)CC(N1C(CC(c2ccc(C)cc2C)=N1)c1ccc(cc1OC)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3908 |
| logD: | 5.2103 |
| logSw: | -5.3235 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.765 |
| InChI Key: | FRMOZDFEGHFFQN-VWLOTQADSA-N |