N-[4-(dimethylamino)-3-({3,3-dimethyl-N-[(oxolan-2-yl)methyl]butanamido}methyl)phenyl]-3-fluorobenzamide
Chemical Structure Depiction of
N-[4-(dimethylamino)-3-({3,3-dimethyl-N-[(oxolan-2-yl)methyl]butanamido}methyl)phenyl]-3-fluorobenzamide
N-[4-(dimethylamino)-3-({3,3-dimethyl-N-[(oxolan-2-yl)methyl]butanamido}methyl)phenyl]-3-fluorobenzamide
Compound characteristics
| Compound ID: | V026-8290 |
| Compound Name: | N-[4-(dimethylamino)-3-({3,3-dimethyl-N-[(oxolan-2-yl)methyl]butanamido}methyl)phenyl]-3-fluorobenzamide |
| Molecular Weight: | 469.6 |
| Molecular Formula: | C27 H36 F N3 O3 |
| Salt: | not_available |
| Smiles: | CC(C)(C)CC(N(CC1CCCO1)Cc1cc(ccc1N(C)C)NC(c1cccc(c1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7844 |
| logD: | 4.7815 |
| logSw: | -4.6822 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.171 |
| InChI Key: | MTSLBPSODCKSOO-HSZRJFAPSA-N |