4-chloro-N-(2-{4-[6-(2,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
Chemical Structure Depiction of
4-chloro-N-(2-{4-[6-(2,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
4-chloro-N-(2-{4-[6-(2,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide
Compound characteristics
| Compound ID: | V026-8411 |
| Compound Name: | 4-chloro-N-(2-{4-[6-(2,4-dichlorophenyl)pyridazin-3-yl]piperazin-1-yl}-2-oxoethyl)-N-(1-phenylethyl)benzamide |
| Molecular Weight: | 608.96 |
| Molecular Formula: | C31 H28 Cl3 N5 O2 |
| Salt: | not_available |
| Smiles: | CC(c1ccccc1)N(CC(N1CCN(CC1)c1ccc(c2ccc(cc2[Cl])[Cl])nn1)=O)C(c1ccc(cc1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.468 |
| logD: | 6.4642 |
| logSw: | -6.1944 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.13 |
| InChI Key: | CIWCMMYJMJVTQX-NRFANRHFSA-N |