N~3~-(6,8-dichloro-2-ethylquinazolin-4-yl)-N~3~-[(furan-2-yl)methyl]-N-(2-methoxyethyl)-beta-alaninamide
Chemical Structure Depiction of
N~3~-(6,8-dichloro-2-ethylquinazolin-4-yl)-N~3~-[(furan-2-yl)methyl]-N-(2-methoxyethyl)-beta-alaninamide
N~3~-(6,8-dichloro-2-ethylquinazolin-4-yl)-N~3~-[(furan-2-yl)methyl]-N-(2-methoxyethyl)-beta-alaninamide
Compound characteristics
| Compound ID: | V026-8487 |
| Compound Name: | N~3~-(6,8-dichloro-2-ethylquinazolin-4-yl)-N~3~-[(furan-2-yl)methyl]-N-(2-methoxyethyl)-beta-alaninamide |
| Molecular Weight: | 451.35 |
| Molecular Formula: | C21 H24 Cl2 N4 O3 |
| Salt: | not_available |
| Smiles: | CCc1nc(c2cc(cc(c2n1)[Cl])[Cl])N(CCC(NCCOC)=O)Cc1ccco1 |
| Stereo: | ACHIRAL |
| logP: | 4.1857 |
| logD: | 3.9569 |
| logSw: | -4.4777 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.616 |
| InChI Key: | HAMXQSVZFCPKDM-UHFFFAOYSA-N |