[4-({2-[(2-fluorophenyl)methyl]-5,6-dimethyl-1H-benzimidazol-1-yl}methyl)phenyl](morpholin-4-yl)methanone
Chemical Structure Depiction of
[4-({2-[(2-fluorophenyl)methyl]-5,6-dimethyl-1H-benzimidazol-1-yl}methyl)phenyl](morpholin-4-yl)methanone
[4-({2-[(2-fluorophenyl)methyl]-5,6-dimethyl-1H-benzimidazol-1-yl}methyl)phenyl](morpholin-4-yl)methanone
Compound characteristics
| Compound ID: | V026-8736 |
| Compound Name: | [4-({2-[(2-fluorophenyl)methyl]-5,6-dimethyl-1H-benzimidazol-1-yl}methyl)phenyl](morpholin-4-yl)methanone |
| Molecular Weight: | 457.55 |
| Molecular Formula: | C28 H28 F N3 O2 |
| Salt: | not_available |
| Smiles: | Cc1cc2c(cc1C)n(Cc1ccc(cc1)C(N1CCOCC1)=O)c(Cc1ccccc1F)n2 |
| Stereo: | ACHIRAL |
| logP: | 5.1943 |
| logD: | 5.1899 |
| logSw: | -5.0987 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.429 |
| InChI Key: | RPDRGVRERHJHDQ-UHFFFAOYSA-N |