N-(2-methoxyethyl)-N-{[5-(4-methoxyphenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}furan-2-carboxamide
Chemical Structure Depiction of
N-(2-methoxyethyl)-N-{[5-(4-methoxyphenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}furan-2-carboxamide
N-(2-methoxyethyl)-N-{[5-(4-methoxyphenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}furan-2-carboxamide
Compound characteristics
| Compound ID: | V026-8986 |
| Compound Name: | N-(2-methoxyethyl)-N-{[5-(4-methoxyphenoxy)-1-methyl-3-phenyl-1H-pyrazol-4-yl]methyl}furan-2-carboxamide |
| Molecular Weight: | 461.52 |
| Molecular Formula: | C26 H27 N3 O5 |
| Salt: | not_available |
| Smiles: | Cn1c(c(CN(CCOC)C(c2ccco2)=O)c(c2ccccc2)n1)Oc1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.6599 |
| logD: | 3.6599 |
| logSw: | -3.9165 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.917 |
| InChI Key: | QVGQNCSDMWESHW-UHFFFAOYSA-N |