3,6-dimethyl-5-[(3-methylphenyl)methyl]-2-{[(3-methylphenyl)methyl]sulfanyl}pyrimidin-4(3H)-one
Chemical Structure Depiction of
3,6-dimethyl-5-[(3-methylphenyl)methyl]-2-{[(3-methylphenyl)methyl]sulfanyl}pyrimidin-4(3H)-one
3,6-dimethyl-5-[(3-methylphenyl)methyl]-2-{[(3-methylphenyl)methyl]sulfanyl}pyrimidin-4(3H)-one
Compound characteristics
| Compound ID: | V026-9078 |
| Compound Name: | 3,6-dimethyl-5-[(3-methylphenyl)methyl]-2-{[(3-methylphenyl)methyl]sulfanyl}pyrimidin-4(3H)-one |
| Molecular Weight: | 364.51 |
| Molecular Formula: | C22 H24 N2 O S |
| Smiles: | CC1=C(Cc2cccc(C)c2)C(N(C)C(=N1)SCc1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2354 |
| logD: | 5.2354 |
| logSw: | -5.0824 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 25.1882 |
| InChI Key: | OHIXKOJYOAZCRR-UHFFFAOYSA-N |