N~2~-(4-methylbenzene-1-sulfonyl)-N-[(5-methylfuran-2-yl)methyl]-N~2~-pentyl-N-(2-phenylethyl)glycinamide
					Chemical Structure Depiction of
N~2~-(4-methylbenzene-1-sulfonyl)-N-[(5-methylfuran-2-yl)methyl]-N~2~-pentyl-N-(2-phenylethyl)glycinamide
			N~2~-(4-methylbenzene-1-sulfonyl)-N-[(5-methylfuran-2-yl)methyl]-N~2~-pentyl-N-(2-phenylethyl)glycinamide
Compound characteristics
| Compound ID: | V026-9602 | 
| Compound Name: | N~2~-(4-methylbenzene-1-sulfonyl)-N-[(5-methylfuran-2-yl)methyl]-N~2~-pentyl-N-(2-phenylethyl)glycinamide | 
| Molecular Weight: | 496.67 | 
| Molecular Formula: | C28 H36 N2 O4 S | 
| Smiles: | CCCCCN(CC(N(CCc1ccccc1)Cc1ccc(C)o1)=O)S(c1ccc(C)cc1)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 6.1552 | 
| logD: | 6.1552 | 
| logSw: | -5.3573 | 
| Hydrogen bond acceptors count: | 8 | 
| Polar surface area: | 54.517 | 
| InChI Key: | FYHLBMWAQFIPST-UHFFFAOYSA-N | 
 
				 
				