7-(4-cyclohexylphenyl)-2-[4-(4-ethylbenzene-1-sulfonyl)piperazin-1-yl][1,2,4]triazolo[1,5-a]pyrimidine
Chemical Structure Depiction of
7-(4-cyclohexylphenyl)-2-[4-(4-ethylbenzene-1-sulfonyl)piperazin-1-yl][1,2,4]triazolo[1,5-a]pyrimidine
7-(4-cyclohexylphenyl)-2-[4-(4-ethylbenzene-1-sulfonyl)piperazin-1-yl][1,2,4]triazolo[1,5-a]pyrimidine
Compound characteristics
| Compound ID: | V027-0509 |
| Compound Name: | 7-(4-cyclohexylphenyl)-2-[4-(4-ethylbenzene-1-sulfonyl)piperazin-1-yl][1,2,4]triazolo[1,5-a]pyrimidine |
| Molecular Weight: | 530.69 |
| Molecular Formula: | C29 H34 N6 O2 S |
| Salt: | not_available |
| Smiles: | CCc1ccc(cc1)S(N1CCN(CC1)c1nc2nccc(c3ccc(cc3)C3CCCCC3)n2n1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 6.6498 |
| logD: | 6.6497 |
| logSw: | -5.7433 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 64.032 |
| InChI Key: | CCHACNGMWICGJS-UHFFFAOYSA-N |