N-{[2-(dimethylamino)-5-(3-fluorobenzamido)phenyl]methyl}-4-fluoro-N-(1-phenylethyl)benzamide
Chemical Structure Depiction of
N-{[2-(dimethylamino)-5-(3-fluorobenzamido)phenyl]methyl}-4-fluoro-N-(1-phenylethyl)benzamide
N-{[2-(dimethylamino)-5-(3-fluorobenzamido)phenyl]methyl}-4-fluoro-N-(1-phenylethyl)benzamide
Compound characteristics
| Compound ID: | V027-0658 |
| Compound Name: | N-{[2-(dimethylamino)-5-(3-fluorobenzamido)phenyl]methyl}-4-fluoro-N-(1-phenylethyl)benzamide |
| Molecular Weight: | 513.59 |
| Molecular Formula: | C31 H29 F2 N3 O2 |
| Salt: | not_available |
| Smiles: | CC(c1ccccc1)N(Cc1cc(ccc1N(C)C)NC(c1cccc(c1)F)=O)C(c1ccc(cc1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.4393 |
| logD: | 6.4264 |
| logSw: | -5.7445 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.137 |
| InChI Key: | SGXNQJNZDULXGV-NRFANRHFSA-N |