N-(butan-2-yl)-3-[2-(4-chlorophenyl)-6-phenylimidazo[1,2-a]pyridin-3-yl]propanamide
Chemical Structure Depiction of
N-(butan-2-yl)-3-[2-(4-chlorophenyl)-6-phenylimidazo[1,2-a]pyridin-3-yl]propanamide
N-(butan-2-yl)-3-[2-(4-chlorophenyl)-6-phenylimidazo[1,2-a]pyridin-3-yl]propanamide
Compound characteristics
| Compound ID: | V027-1506 |
| Compound Name: | N-(butan-2-yl)-3-[2-(4-chlorophenyl)-6-phenylimidazo[1,2-a]pyridin-3-yl]propanamide |
| Molecular Weight: | 431.96 |
| Molecular Formula: | C26 H26 Cl N3 O |
| Salt: | not_available |
| Smiles: | CCC(C)NC(CCc1c(c2ccc(cc2)[Cl])nc2ccc(cn12)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.8177 |
| logD: | 5.807 |
| logSw: | -6.0376 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.139 |
| InChI Key: | KNFOSWKZAIBFSB-SFHVURJKSA-N |