cyclobutyl(4-{6-(methoxymethyl)-5-[(4-methoxyphenyl)methyl]-2-methylpyrimidin-4-yl}piperazin-1-yl)methanone
Chemical Structure Depiction of
cyclobutyl(4-{6-(methoxymethyl)-5-[(4-methoxyphenyl)methyl]-2-methylpyrimidin-4-yl}piperazin-1-yl)methanone
cyclobutyl(4-{6-(methoxymethyl)-5-[(4-methoxyphenyl)methyl]-2-methylpyrimidin-4-yl}piperazin-1-yl)methanone
Compound characteristics
| Compound ID: | V027-1523 |
| Compound Name: | cyclobutyl(4-{6-(methoxymethyl)-5-[(4-methoxyphenyl)methyl]-2-methylpyrimidin-4-yl}piperazin-1-yl)methanone |
| Molecular Weight: | 424.54 |
| Molecular Formula: | C24 H32 N4 O3 |
| Smiles: | Cc1nc(COC)c(Cc2ccc(cc2)OC)c(n1)N1CCN(CC1)C(C1CCC1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.132 |
| logD: | 3.0698 |
| logSw: | -2.9676 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.749 |
| InChI Key: | QIUWMDHDMZUUEY-UHFFFAOYSA-N |