(4-{2-(butan-2-yl)-6-(methoxymethyl)-5-[(3-methylphenyl)methyl]pyrimidin-4-yl}piperazin-1-yl)(thiophen-2-yl)methanone
Chemical Structure Depiction of
(4-{2-(butan-2-yl)-6-(methoxymethyl)-5-[(3-methylphenyl)methyl]pyrimidin-4-yl}piperazin-1-yl)(thiophen-2-yl)methanone
(4-{2-(butan-2-yl)-6-(methoxymethyl)-5-[(3-methylphenyl)methyl]pyrimidin-4-yl}piperazin-1-yl)(thiophen-2-yl)methanone
Compound characteristics
| Compound ID: | V027-1564 |
| Compound Name: | (4-{2-(butan-2-yl)-6-(methoxymethyl)-5-[(3-methylphenyl)methyl]pyrimidin-4-yl}piperazin-1-yl)(thiophen-2-yl)methanone |
| Molecular Weight: | 478.66 |
| Molecular Formula: | C27 H34 N4 O2 S |
| Salt: | not_available |
| Smiles: | CCC(C)c1nc(COC)c(Cc2cccc(C)c2)c(n1)N1CCN(CC1)C(c1cccs1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.2095 |
| logD: | 6.0896 |
| logSw: | -5.4233 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.088 |
| InChI Key: | SXUYBSFYJVXNOZ-FQEVSTJZSA-N |