3-fluoro-N-{2-[3-(4-fluorophenyl)-5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)benzamide
Chemical Structure Depiction of
3-fluoro-N-{2-[3-(4-fluorophenyl)-5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)benzamide
3-fluoro-N-{2-[3-(4-fluorophenyl)-5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)benzamide
Compound characteristics
| Compound ID: | V027-3416 |
| Compound Name: | 3-fluoro-N-{2-[3-(4-fluorophenyl)-5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazol-1-yl]-2-oxoethyl}-N-(2-methoxyethyl)benzamide |
| Molecular Weight: | 507.54 |
| Molecular Formula: | C28 H27 F2 N3 O4 |
| Salt: | not_available |
| Smiles: | COCCN(CC(N1C(CC(c2ccc(cc2)F)=N1)c1ccccc1OC)=O)C(c1cccc(c1)F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.347 |
| logD: | 4.347 |
| logSw: | -4.4189 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 59.021 |
| InChI Key: | SZGKSOFYDXQKER-VWLOTQADSA-N |