2-[3-(2,3-dimethylphenyl)-6-methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl]-N-(1-phenylethyl)acetamide
Chemical Structure Depiction of
2-[3-(2,3-dimethylphenyl)-6-methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl]-N-(1-phenylethyl)acetamide
2-[3-(2,3-dimethylphenyl)-6-methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl]-N-(1-phenylethyl)acetamide
Compound characteristics
| Compound ID: | V027-3568 |
| Compound Name: | 2-[3-(2,3-dimethylphenyl)-6-methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl]-N-(1-phenylethyl)acetamide |
| Molecular Weight: | 441.53 |
| Molecular Formula: | C27 H27 N3 O3 |
| Smiles: | CC(c1ccccc1)NC(CN1C(N(C(c2cc(C)ccc12)=O)c1cccc(C)c1C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4367 |
| logD: | 4.4367 |
| logSw: | -4.3534 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.989 |
| InChI Key: | HDLRAMGLIMGDSE-FQEVSTJZSA-N |