4-[(2-chloro-N-cyclopropylbenzamido)methyl]phenyl 2-chloro-6-methylbenzene-1-sulfonate
Chemical Structure Depiction of
4-[(2-chloro-N-cyclopropylbenzamido)methyl]phenyl 2-chloro-6-methylbenzene-1-sulfonate
4-[(2-chloro-N-cyclopropylbenzamido)methyl]phenyl 2-chloro-6-methylbenzene-1-sulfonate
Compound characteristics
| Compound ID: | V027-3983 |
| Compound Name: | 4-[(2-chloro-N-cyclopropylbenzamido)methyl]phenyl 2-chloro-6-methylbenzene-1-sulfonate |
| Molecular Weight: | 490.4 |
| Molecular Formula: | C24 H21 Cl2 N O4 S |
| Smiles: | Cc1cccc(c1S(=O)(=O)Oc1ccc(CN(C2CC2)C(c2ccccc2[Cl])=O)cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.3755 |
| logD: | 5.3755 |
| logSw: | -5.7692 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 51.515 |
| InChI Key: | YFNFHHZVZGTSLB-UHFFFAOYSA-N |