3-chloro-N-[4-({4-(3,4-dimethylanilino)-1-[(furan-2-yl)methyl]-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl}sulfanyl)phenyl]benzamide
Chemical Structure Depiction of
3-chloro-N-[4-({4-(3,4-dimethylanilino)-1-[(furan-2-yl)methyl]-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl}sulfanyl)phenyl]benzamide
3-chloro-N-[4-({4-(3,4-dimethylanilino)-1-[(furan-2-yl)methyl]-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl}sulfanyl)phenyl]benzamide
Compound characteristics
| Compound ID: | V027-4079 |
| Compound Name: | 3-chloro-N-[4-({4-(3,4-dimethylanilino)-1-[(furan-2-yl)methyl]-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl}sulfanyl)phenyl]benzamide |
| Molecular Weight: | 558.06 |
| Molecular Formula: | C30 H24 Cl N3 O4 S |
| Salt: | not_available |
| Smiles: | Cc1ccc(cc1C)NC1=C(C(N(Cc2ccco2)C1=O)=O)Sc1ccc(cc1)NC(c1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.6201 |
| logD: | 6.6189 |
| logSw: | -6.2556 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.443 |
| InChI Key: | QFSUFVNACPHLSJ-UHFFFAOYSA-N |