(4-{[6-(3-ethoxyphenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl}piperazin-1-yl)(4-methoxyphenyl)methanone
Chemical Structure Depiction of
(4-{[6-(3-ethoxyphenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl}piperazin-1-yl)(4-methoxyphenyl)methanone
(4-{[6-(3-ethoxyphenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl}piperazin-1-yl)(4-methoxyphenyl)methanone
Compound characteristics
| Compound ID: | V027-4119 |
| Compound Name: | (4-{[6-(3-ethoxyphenyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl}piperazin-1-yl)(4-methoxyphenyl)methanone |
| Molecular Weight: | 564.66 |
| Molecular Formula: | C34 H33 F N4 O3 |
| Salt: | not_available |
| Smiles: | CCOc1cccc(c1)c1ccc2nc(c3ccc(cc3)F)c(CN3CCN(CC3)C(c3ccc(cc3)OC)=O)n2c1 |
| Stereo: | ACHIRAL |
| logP: | 5.6845 |
| logD: | 5.6822 |
| logSw: | -5.3444 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.083 |
| InChI Key: | OGLVGEJHTPCBIO-UHFFFAOYSA-N |