2-(2,3-dichloroanilino)-N-methyl-N-[2-oxo-2-({[3-(trifluoromethyl)phenyl]methyl}amino)ethyl]-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
2-(2,3-dichloroanilino)-N-methyl-N-[2-oxo-2-({[3-(trifluoromethyl)phenyl]methyl}amino)ethyl]-1,3-thiazole-4-carboxamide
2-(2,3-dichloroanilino)-N-methyl-N-[2-oxo-2-({[3-(trifluoromethyl)phenyl]methyl}amino)ethyl]-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | V027-4604 |
| Compound Name: | 2-(2,3-dichloroanilino)-N-methyl-N-[2-oxo-2-({[3-(trifluoromethyl)phenyl]methyl}amino)ethyl]-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 517.36 |
| Molecular Formula: | C21 H17 Cl2 F3 N4 O2 S |
| Salt: | not_available |
| Smiles: | CN(CC(NCc1cccc(c1)C(F)(F)F)=O)C(c1csc(Nc2cccc(c2[Cl])[Cl])n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5095 |
| logD: | 5.5095 |
| logSw: | -6.1177 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.121 |
| InChI Key: | UIXMIKCOJASLOM-UHFFFAOYSA-N |